C27H35NSi — CID 123774727
N-diphenylsilyl-N-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)cyclohexanamine (PubChem CID 123774727) has the molecular formula C27H35NSi and a molecular weight of 401.67 g/mol. Its IUPAC name is N-diphenylsilyl-N-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)cyclohexanamine.
| Compound Name | N-diphenylsilyl-N-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)cyclohexanamine |
|---|---|
| PubChem CID | 123774727 |
| Molecular Formula | C27H35NSi |
| Molecular Weight | 401.67 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | N-diphenylsilyl-N-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)cyclohexanamine |
| SMILES | CC1=C(C)C(C)C(N(C2CCCCC2)[SiH](c2ccccc2)c2ccccc2)=C1C |
| InChI | InChI=1S/C27H35NSi/c1-20-21(2)23(4)27(22(20)3)28(24-14-8-5-9-15-24)29(25-16-10-6-11-17-25)26-18-12-7-13-19-26/h6-7,10-13,16-19,22,24,29H,5,8-9,14-15H2,1-4H3 |
| InChIKey | ALTHJGIPNPXTQX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.67 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|