C24H22FN5O — CID 135850595
2-[2-amino-3-(2-amino-3-phenylpropyl)-5-fluorophenyl]-4-pyridin-4-yl-1H-pyrimidin-6-one (PubChem CID 135850595) has the molecular formula C24H22FN5O and a molecular weight of 415.47 g/mol. Its IUPAC name is 2-[2-amino-3-(2-amino-3-phenylpropyl)-5-fluorophenyl]-4-pyridin-4-yl-1H-pyrimidin-6-one.
| Compound Name | 2-[2-amino-3-(2-amino-3-phenylpropyl)-5-fluorophenyl]-4-pyridin-4-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135850595 |
| Molecular Formula | C24H22FN5O |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 2-[2-amino-3-(2-amino-3-phenylpropyl)-5-fluorophenyl]-4-pyridin-4-yl-1H-pyrimidin-6-one |
| SMILES | Nc1c(CC(N)Cc2ccccc2)cc(F)cc1-c1nc(-c2ccncc2)cc(=O)[nH]1 |
| InChI | InChI=1S/C24H22FN5O/c25-18-11-17(12-19(26)10-15-4-2-1-3-5-15)23(27)20(13-18)24-29-21(14-22(31)30-24)16-6-8-28-9-7-16/h1-9,11,13-14,19H,10,12,26-27H2,(H,29,30,31) |
| InChIKey | FXZSKPSVNDQNHL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|