C8H13N5O2 — CID 135850746
4,5-diamino-2-morpholin-4-yl-1H-pyrimidin-6-one (PubChem CID 135850746) has the molecular formula C8H13N5O2 and a molecular weight of 211.22 g/mol. Its IUPAC name is 4,5-diamino-2-morpholin-4-yl-1H-pyrimidin-6-one.
| Compound Name | 4,5-diamino-2-morpholin-4-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135850746 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 4,5-diamino-2-morpholin-4-yl-1H-pyrimidin-6-one |
| SMILES | Nc1nc(N2CCOCC2)[nH]c(=O)c1N |
| InChI | InChI=1S/C8H13N5O2/c9-5-6(10)11-8(12-7(5)14)13-1-3-15-4-2-13/h1-4,9H2,(H3,10,11,12,14) |
| InChIKey | NOLJXMCFKMQSHH-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |