C9H15N5O2 — CID 139217219
5,6-diamino-3-methyl-2-morpholin-4-ylpyrimidin-4-one (PubChem CID 139217219) has the molecular formula C9H15N5O2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 5,6-diamino-3-methyl-2-morpholin-4-ylpyrimidin-4-one.
| Compound Name | 5,6-diamino-3-methyl-2-morpholin-4-ylpyrimidin-4-one |
|---|---|
| PubChem CID | 139217219 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 5,6-diamino-3-methyl-2-morpholin-4-ylpyrimidin-4-one |
| SMILES | Cn1c(N2CCOCC2)nc(N)c(N)c1=O |
| InChI | InChI=1S/C9H15N5O2/c1-13-8(15)6(10)7(11)12-9(13)14-2-4-16-5-3-14/h2-5,10-11H2,1H3 |
| InChIKey | UHTZHSQEITYSKW-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |