C17H17N4O4S- — CID 135851589
3-[[2-[(2Z,5S)-4-oxo-2-[(Z)-[(E)-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-5-yl]acetyl]amino]propanoate (PubChem CID 135851589) has the molecular formula C17H17N4O4S- and a molecular weight of 373.41 g/mol. Its IUPAC name is 3-[[2-[(2Z,5S)-4-oxo-2-[(Z)-[(E)-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-5-yl]acetyl]amino]propanoate.
| Compound Name | 3-[[2-[(2Z,5S)-4-oxo-2-[(Z)-[(E)-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-5-yl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 135851589 |
| Molecular Formula | C17H17N4O4S- |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 3-[[2-[(2Z,5S)-4-oxo-2-[(Z)-[(E)-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-5-yl]acetyl]amino]propanoate |
| SMILES | O=C([O-])CCNC(=O)C[C@@H]1S/C(=N\N=C/C=C/c2ccccc2)NC1=O |
| InChI | InChI=1S/C17H18N4O4S/c22-14(18-10-8-15(23)24)11-13-16(25)20-17(26-13)21-19-9-4-7-12-5-2-1-3-6-12/h1-7,9,13H,8,10-11H2,(H,18,22)(H,23,24)(H,20,21,25)/p-1/b7-4+,19-9-/t13-/m0/s1 |
| InChIKey | RHFIQFYSCHARNQ-ZVJCYUSASA-M |
| XLogP | -0.08 |
| TPSA | 123.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_imine_B(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|