C24H25N5O3S — CID 135852810
(2R)-N-(1-ethyl-2-hydroxyindol-3-yl)imino-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]propanamide (PubChem CID 135852810) has the molecular formula C24H25N5O3S and a molecular weight of 463.56 g/mol. Its IUPAC name is (2R)-N-(1-ethyl-2-hydroxyindol-3-yl)imino-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]propanamide.
| Compound Name | (2R)-N-(1-ethyl-2-hydroxyindol-3-yl)imino-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]propanamide |
|---|---|
| PubChem CID | 135852810 |
| Molecular Formula | C24H25N5O3S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | (2R)-N-(1-ethyl-2-hydroxyindol-3-yl)imino-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]propanamide |
| SMILES | CCn1c(O)c(/N=N/C(=O)[C@@H](C)n2cnc3sc4c(c3c2=O)CC[C@@H](C)C4)c2ccccc21 |
| InChI | InChI=1S/C24H25N5O3S/c1-4-28-17-8-6-5-7-15(17)20(24(28)32)26-27-21(30)14(3)29-12-25-22-19(23(29)31)16-10-9-13(2)11-18(16)33-22/h5-8,12-14,32H,4,9-11H2,1-3H3/b27-26+/t13-,14-/m1/s1 |
| InChIKey | YHVGYYBSSWMKMG-PPFPOHFJSA-N |
| XLogP | 5.13 |
| TPSA | 101.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|