C15H12F2N2O4 — CID 135855273
4-[(2,2-difluoro-1,3-benzodioxol-5-yl)iminomethyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol (PubChem CID 135855273) has the molecular formula C15H12F2N2O4 and a molecular weight of 322.27 g/mol. Its IUPAC name is 4-[(2,2-difluoro-1,3-benzodioxol-5-yl)iminomethyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol.
| Compound Name | 4-[(2,2-difluoro-1,3-benzodioxol-5-yl)iminomethyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol |
|---|---|
| PubChem CID | 135855273 |
| Molecular Formula | C15H12F2N2O4 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 4-[(2,2-difluoro-1,3-benzodioxol-5-yl)iminomethyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol |
| SMILES | Cc1ncc(CO)c(/C=N/c2ccc3c(c2)OC(F)(F)O3)c1O |
| InChI | InChI=1S/C15H12F2N2O4/c1-8-14(21)11(9(7-20)5-18-8)6-19-10-2-3-12-13(4-10)23-15(16,17)22-12/h2-6,20-21H,7H2,1H3/b19-6+ |
| InChIKey | RONYCQIMFVWSGP-KPSZGOFPSA-N |
| XLogP | 2.66 |
| TPSA | 84.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|