C15H19N2O6P — CID 172694491
5-(hydroxymethyl)-2-methyl-4-[(4-methylphenyl)iminomethyl]pyridin-3-ol;phosphoric acid (PubChem CID 172694491) has the molecular formula C15H19N2O6P and a molecular weight of 354.30 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-methyl-4-[(4-methylphenyl)iminomethyl]pyridin-3-ol;phosphoric acid.
| Compound Name | 5-(hydroxymethyl)-2-methyl-4-[(4-methylphenyl)iminomethyl]pyridin-3-ol;phosphoric acid |
|---|---|
| PubChem CID | 172694491 |
| Molecular Formula | C15H19N2O6P |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 5-(hydroxymethyl)-2-methyl-4-[(4-methylphenyl)iminomethyl]pyridin-3-ol;phosphoric acid |
| SMILES | Cc1ccc(/N=C/c2c(CO)cnc(C)c2O)cc1.O=P(O)(O)O |
| InChI | InChI=1S/C15H16N2O2.H3O4P/c1-10-3-5-13(6-4-10)17-8-14-12(9-18)7-16-11(2)15(14)19;1-5(2,3)4/h3-8,18-19H,9H2,1-2H3;(H3,1,2,3,4)/b17-8+; |
| InChIKey | CDFDTIUQBUSVSI-XIDBHWPPSA-N |
| XLogP | 1.72 |
| TPSA | 143.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|