C11H9N5OS2 — CID 135856146
2-[(5-amino-1,3,4-thiadiazol-2-yl)-sulfanylmethyl]-3H-quinazolin-4-one (PubChem CID 135856146) has the molecular formula C11H9N5OS2 and a molecular weight of 291.36 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)-sulfanylmethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)-sulfanylmethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135856146 |
| Molecular Formula | C11H9N5OS2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)-sulfanylmethyl]-3H-quinazolin-4-one |
| SMILES | Nc1nnc(C(S)c2nc3ccccc3c(=O)[nH]2)s1 |
| InChI | InChI=1S/C11H9N5OS2/c12-11-16-15-10(19-11)7(18)8-13-6-4-2-1-3-5(6)9(17)14-8/h1-4,7,18H,(H2,12,16)(H,13,14,17) |
| InChIKey | NWPWEEODBLTTGM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|