C18H14ClN3O3S — CID 135856895
8-chloro-2-[(3-hydroxy-4-methoxyanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one (PubChem CID 135856895) has the molecular formula C18H14ClN3O3S and a molecular weight of 387.85 g/mol. Its IUPAC name is 8-chloro-2-[(3-hydroxy-4-methoxyanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one.
| Compound Name | 8-chloro-2-[(3-hydroxy-4-methoxyanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135856895 |
| Molecular Formula | C18H14ClN3O3S |
| Molecular Weight | 387.85 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 8-chloro-2-[(3-hydroxy-4-methoxyanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
| SMILES | COc1ccc(NCc2nc3c(sc4ccc(Cl)cc43)c(=O)[nH]2)cc1O |
| InChI | InChI=1S/C18H14ClN3O3S/c1-25-13-4-3-10(7-12(13)23)20-8-15-21-16-11-6-9(19)2-5-14(11)26-17(16)18(24)22-15/h2-7,20,23H,8H2,1H3,(H,21,22,24) |
| InChIKey | NGSZNGYSCNBCOH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.85 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|