C24H33N5O6 — CID 135858101
5-(carbamoylamino)-2-[[3-(4,5-diethyl-6-oxo-1H-pyrimidin-2-yl)-4-propoxybenzoyl]amino]pentanoic acid (PubChem CID 135858101) has the molecular formula C24H33N5O6 and a molecular weight of 487.56 g/mol. Its IUPAC name is 5-(carbamoylamino)-2-[[3-(4,5-diethyl-6-oxo-1H-pyrimidin-2-yl)-4-propoxybenzoyl]amino]pentanoic acid.
| Compound Name | 5-(carbamoylamino)-2-[[3-(4,5-diethyl-6-oxo-1H-pyrimidin-2-yl)-4-propoxybenzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 135858101 |
| Molecular Formula | C24H33N5O6 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 5-(carbamoylamino)-2-[[3-(4,5-diethyl-6-oxo-1H-pyrimidin-2-yl)-4-propoxybenzoyl]amino]pentanoic acid |
| SMILES | CCCOc1ccc(C(=O)NC(CCCNC(N)=O)C(=O)O)cc1-c1nc(CC)c(CC)c(=O)[nH]1 |
| InChI | InChI=1S/C24H33N5O6/c1-4-12-35-19-10-9-14(21(30)28-18(23(32)33)8-7-11-26-24(25)34)13-16(19)20-27-17(6-3)15(5-2)22(31)29-20/h9-10,13,18H,4-8,11-12H2,1-3H3,(H,28,30)(H,32,33)(H3,25,26,34)(H,27,29,31) |
| InChIKey | TXPPMUGRFJDXFS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 176.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|