C21H28N4O4 — CID 137079181
N-(1-amino-3-oxopropyl)-3-(4,5-diethyl-6-oxo-1H-pyrimidin-2-yl)-4-propoxybenzamide (PubChem CID 137079181) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-(1-amino-3-oxopropyl)-3-(4,5-diethyl-6-oxo-1H-pyrimidin-2-yl)-4-propoxybenzamide.
| Compound Name | N-(1-amino-3-oxopropyl)-3-(4,5-diethyl-6-oxo-1H-pyrimidin-2-yl)-4-propoxybenzamide |
|---|---|
| PubChem CID | 137079181 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | N-(1-amino-3-oxopropyl)-3-(4,5-diethyl-6-oxo-1H-pyrimidin-2-yl)-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)NC(N)CC=O)cc1-c1nc(CC)c(CC)c(=O)[nH]1 |
| InChI | InChI=1S/C21H28N4O4/c1-4-11-29-17-8-7-13(20(27)24-18(22)9-10-26)12-15(17)19-23-16(6-3)14(5-2)21(28)25-19/h7-8,10,12,18H,4-6,9,11,22H2,1-3H3,(H,24,27)(H,23,25,28) |
| InChIKey | IZADTZPCOUNLGE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|