C19H23N3O2S — CID 135858414
2-methyl-4-[(3R)-1-[2-(2-methylphenyl)sulfanylacetyl]piperidin-3-yl]-1H-pyrimidin-6-one (PubChem CID 135858414) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is 2-methyl-4-[(3R)-1-[2-(2-methylphenyl)sulfanylacetyl]piperidin-3-yl]-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-4-[(3R)-1-[2-(2-methylphenyl)sulfanylacetyl]piperidin-3-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135858414 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 2-methyl-4-[(3R)-1-[2-(2-methylphenyl)sulfanylacetyl]piperidin-3-yl]-1H-pyrimidin-6-one |
| SMILES | Cc1nc([C@@H]2CCCN(C(=O)CSc3ccccc3C)C2)cc(=O)[nH]1 |
| InChI | InChI=1S/C19H23N3O2S/c1-13-6-3-4-8-17(13)25-12-19(24)22-9-5-7-15(11-22)16-10-18(23)21-14(2)20-16/h3-4,6,8,10,15H,5,7,9,11-12H2,1-2H3,(H,20,21,23)/t15-/m1/s1 |
| InChIKey | PEHHZTMFDXMWGZ-OAHLLOKOSA-N |
| XLogP | 2.89 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |