C17H18N6O2 — CID 136861424
4-[(3R)-1-(2H-benzotriazole-5-carbonyl)piperidin-3-yl]-2-methyl-1H-pyrimidin-6-one (PubChem CID 136861424) has the molecular formula C17H18N6O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is 4-[(3R)-1-(2H-benzotriazole-5-carbonyl)piperidin-3-yl]-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-[(3R)-1-(2H-benzotriazole-5-carbonyl)piperidin-3-yl]-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136861424 |
| Molecular Formula | C17H18N6O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 4-[(3R)-1-(2H-benzotriazole-5-carbonyl)piperidin-3-yl]-2-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc([C@@H]2CCCN(C(=O)c3ccc4n[nH]nc4c3)C2)cc(=O)[nH]1 |
| InChI | InChI=1S/C17H18N6O2/c1-10-18-14(8-16(24)19-10)12-3-2-6-23(9-12)17(25)11-4-5-13-15(7-11)21-22-20-13/h4-5,7-8,12H,2-3,6,9H2,1H3,(H,18,19,24)(H,20,21,22)/t12-/m1/s1 |
| InChIKey | VPPFIFGNUJMFJK-GFCCVEGCSA-N |
| XLogP | 1.37 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |