C13H17N5O3S — CID 135860584
N-hydroxy-4-[[(E)-(2-hydroxyphenyl)methylideneamino]carbamothioyl]piperazine-1-carboxamide (PubChem CID 135860584) has the molecular formula C13H17N5O3S and a molecular weight of 323.38 g/mol. Its IUPAC name is N-hydroxy-4-[[(E)-(2-hydroxyphenyl)methylideneamino]carbamothioyl]piperazine-1-carboxamide.
| Compound Name | N-hydroxy-4-[[(E)-(2-hydroxyphenyl)methylideneamino]carbamothioyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 135860584 |
| Molecular Formula | C13H17N5O3S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-hydroxy-4-[[(E)-(2-hydroxyphenyl)methylideneamino]carbamothioyl]piperazine-1-carboxamide |
| SMILES | O=C(NO)N1CCN(C(=S)N/N=C/c2ccccc2O)CC1 |
| InChI | InChI=1S/C13H17N5O3S/c19-11-4-2-1-3-10(11)9-14-15-13(22)18-7-5-17(6-8-18)12(20)16-21/h1-4,9,19,21H,5-8H2,(H,15,22)(H,16,20)/b14-9+ |
| InChIKey | ZBKIYTGKRUNTRB-NTEUORMPSA-N |
| XLogP | 0.32 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|