C14H20N4OS — CID 136504217
4-ethyl-N-[(E)-(2-hydroxyphenyl)methylideneamino]piperazine-1-carbothioamide (PubChem CID 136504217) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is 4-ethyl-N-[(E)-(2-hydroxyphenyl)methylideneamino]piperazine-1-carbothioamide.
| Compound Name | 4-ethyl-N-[(E)-(2-hydroxyphenyl)methylideneamino]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 136504217 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 4-ethyl-N-[(E)-(2-hydroxyphenyl)methylideneamino]piperazine-1-carbothioamide |
| SMILES | CCN1CCN(C(=S)N/N=C/c2ccccc2O)CC1 |
| InChI | InChI=1S/C14H20N4OS/c1-2-17-7-9-18(10-8-17)14(20)16-15-11-12-5-3-4-6-13(12)19/h3-6,11,19H,2,7-10H2,1H3,(H,16,20)/b15-11+ |
| InChIKey | WZEAKKPYNYISEQ-RVDMUPIBSA-N |
| XLogP | 1.24 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|