C16H14N3O6S- — CID 135860937
5-[[2-(furan-2-yl)-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl]methyl]furan-2-sulfonate (PubChem CID 135860937) has the molecular formula C16H14N3O6S- and a molecular weight of 376.37 g/mol. Its IUPAC name is 5-[[2-(furan-2-yl)-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl]methyl]furan-2-sulfonate.
| Compound Name | 5-[[2-(furan-2-yl)-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl]methyl]furan-2-sulfonate |
|---|---|
| PubChem CID | 135860937 |
| Molecular Formula | C16H14N3O6S- |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 5-[[2-(furan-2-yl)-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl]methyl]furan-2-sulfonate |
| SMILES | O=c1[nH]c(-c2ccco2)nc2c1CN(Cc1ccc(S(=O)(=O)[O-])o1)CC2 |
| InChI | InChI=1S/C16H15N3O6S/c20-16-11-9-19(8-10-3-4-14(25-10)26(21,22)23)6-5-12(11)17-15(18-16)13-2-1-7-24-13/h1-4,7H,5-6,8-9H2,(H,17,18,20)(H,21,22,23)/p-1 |
| InChIKey | VPJVTGMPQDEBAY-UHFFFAOYSA-M |
| XLogP | 1.09 |
| TPSA | 132.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|