C18H15ClN3O5S- — CID 135860949
5-[[2-(4-chlorophenyl)-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl]methyl]furan-2-sulfonate (PubChem CID 135860949) has the molecular formula C18H15ClN3O5S- and a molecular weight of 420.85 g/mol. Its IUPAC name is 5-[[2-(4-chlorophenyl)-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl]methyl]furan-2-sulfonate.
| Compound Name | 5-[[2-(4-chlorophenyl)-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl]methyl]furan-2-sulfonate |
|---|---|
| PubChem CID | 135860949 |
| Molecular Formula | C18H15ClN3O5S- |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 5-[[2-(4-chlorophenyl)-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-6-yl]methyl]furan-2-sulfonate |
| SMILES | O=c1[nH]c(-c2ccc(Cl)cc2)nc2c1CN(Cc1ccc(S(=O)(=O)[O-])o1)CC2 |
| InChI | InChI=1S/C18H16ClN3O5S/c19-12-3-1-11(2-4-12)17-20-15-7-8-22(10-14(15)18(23)21-17)9-13-5-6-16(27-13)28(24,25)26/h1-6H,7-10H2,(H,20,21,23)(H,24,25,26)/p-1 |
| InChIKey | ZFHHDRWWZITXLI-UHFFFAOYSA-M |
| XLogP | 2.15 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|