C19H20N4O2 — CID 135860968
2-(4-aminophenyl)-6-[(5-methylfuran-2-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135860968) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 2-(4-aminophenyl)-6-[(5-methylfuran-2-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(4-aminophenyl)-6-[(5-methylfuran-2-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135860968 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-(4-aminophenyl)-6-[(5-methylfuran-2-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc(CN2CCc3nc(-c4ccc(N)cc4)[nH]c(=O)c3C2)o1 |
| InChI | InChI=1S/C19H20N4O2/c1-12-2-7-15(25-12)10-23-9-8-17-16(11-23)19(24)22-18(21-17)13-3-5-14(20)6-4-13/h2-7H,8-11,20H2,1H3,(H,21,22,24) |
| InChIKey | VGGMYNDTKXCFHU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|