C20H20N4O2S — CID 135942555
6-[(5-acetylthiophen-2-yl)methyl]-2-(4-aminophenyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135942555) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is 6-[(5-acetylthiophen-2-yl)methyl]-2-(4-aminophenyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(5-acetylthiophen-2-yl)methyl]-2-(4-aminophenyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135942555 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 6-[(5-acetylthiophen-2-yl)methyl]-2-(4-aminophenyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CC(=O)c1ccc(CN2CCc3nc(-c4ccc(N)cc4)[nH]c(=O)c3C2)s1 |
| InChI | InChI=1S/C20H20N4O2S/c1-12(25)18-7-6-15(27-18)10-24-9-8-17-16(11-24)20(26)23-19(22-17)13-2-4-14(21)5-3-13/h2-7H,8-11,21H2,1H3,(H,22,23,26) |
| InChIKey | KLEJWYMGOGGBKV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|