C17H16ClN5OS — CID 135943776
6-[(2-amino-1,3-thiazol-5-yl)methyl]-2-(4-chlorophenyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135943776) has the molecular formula C17H16ClN5OS and a molecular weight of 373.87 g/mol. Its IUPAC name is 6-[(2-amino-1,3-thiazol-5-yl)methyl]-2-(4-chlorophenyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(2-amino-1,3-thiazol-5-yl)methyl]-2-(4-chlorophenyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135943776 |
| Molecular Formula | C17H16ClN5OS |
| Molecular Weight | 373.87 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 6-[(2-amino-1,3-thiazol-5-yl)methyl]-2-(4-chlorophenyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Nc1ncc(CN2CCc3nc(-c4ccc(Cl)cc4)[nH]c(=O)c3C2)s1 |
| InChI | InChI=1S/C17H16ClN5OS/c18-11-3-1-10(2-4-11)15-21-14-5-6-23(9-13(14)16(24)22-15)8-12-7-20-17(19)25-12/h1-4,7H,5-6,8-9H2,(H2,19,20)(H,21,22,24) |
| InChIKey | NNFGBDZTZLLXEQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.87 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |