C18H14ClF3N4OS — CID 135946442
6-[[2-(4-chlorophenyl)-1,3-thiazol-5-yl]methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135946442) has the molecular formula C18H14ClF3N4OS and a molecular weight of 426.85 g/mol. Its IUPAC name is 6-[[2-(4-chlorophenyl)-1,3-thiazol-5-yl]methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[[2-(4-chlorophenyl)-1,3-thiazol-5-yl]methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135946442 |
| Molecular Formula | C18H14ClF3N4OS |
| Molecular Weight | 426.85 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 6-[[2-(4-chlorophenyl)-1,3-thiazol-5-yl]methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C(F)(F)F)nc2c1CN(Cc1cnc(-c3ccc(Cl)cc3)s1)CC2 |
| InChI | InChI=1S/C18H14ClF3N4OS/c19-11-3-1-10(2-4-11)16-23-7-12(28-16)8-26-6-5-14-13(9-26)15(27)25-17(24-14)18(20,21)22/h1-4,7H,5-6,8-9H2,(H,24,25,27) |
| InChIKey | BLOPDZRSGPUDBT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.85 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |