C18H17FN4OS2 — CID 135946458
6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]methyl]-2-methylsulfanyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135946458) has the molecular formula C18H17FN4OS2 and a molecular weight of 388.49 g/mol. Its IUPAC name is 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]methyl]-2-methylsulfanyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]methyl]-2-methylsulfanyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135946458 |
| Molecular Formula | C18H17FN4OS2 |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 6-[[2-(4-fluorophenyl)-1,3-thiazol-5-yl]methyl]-2-methylsulfanyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CSc1nc2c(c(=O)[nH]1)CN(Cc1cnc(-c3ccc(F)cc3)s1)CC2 |
| InChI | InChI=1S/C18H17FN4OS2/c1-25-18-21-15-6-7-23(10-14(15)16(24)22-18)9-13-8-20-17(26-13)11-2-4-12(19)5-3-11/h2-5,8H,6-7,9-10H2,1H3,(H,21,22,24) |
| InChIKey | ODXAYDCJVUXVDZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |