C22H27N5O2 — CID 135943873
2-(4-aminophenyl)-6-[[5-(diethylamino)furan-2-yl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135943873) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-(4-aminophenyl)-6-[[5-(diethylamino)furan-2-yl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(4-aminophenyl)-6-[[5-(diethylamino)furan-2-yl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135943873 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 2-(4-aminophenyl)-6-[[5-(diethylamino)furan-2-yl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CCN(CC)c1ccc(CN2CCc3nc(-c4ccc(N)cc4)[nH]c(=O)c3C2)o1 |
| InChI | InChI=1S/C22H27N5O2/c1-3-27(4-2)20-10-9-17(29-20)13-26-12-11-19-18(14-26)22(28)25-21(24-19)15-5-7-16(23)8-6-15/h5-10H,3-4,11-14,23H2,1-2H3,(H,24,25,28) |
| InChIKey | YJQKLJVHVJUWGJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|