C17H15IN4O2 — CID 135862418
6-[(5-iodofuran-2-yl)methyl]-2-pyridin-4-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135862418) has the molecular formula C17H15IN4O2 and a molecular weight of 434.24 g/mol. Its IUPAC name is 6-[(5-iodofuran-2-yl)methyl]-2-pyridin-4-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(5-iodofuran-2-yl)methyl]-2-pyridin-4-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135862418 |
| Molecular Formula | C17H15IN4O2 |
| Molecular Weight | 434.24 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | 6-[(5-iodofuran-2-yl)methyl]-2-pyridin-4-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2ccncc2)nc2c1CN(Cc1ccc(I)o1)CC2 |
| InChI | InChI=1S/C17H15IN4O2/c18-15-2-1-12(24-15)9-22-8-5-14-13(10-22)17(23)21-16(20-14)11-3-6-19-7-4-11/h1-4,6-7H,5,8-10H2,(H,20,21,23) |
| InChIKey | RHUKUSNCHVLILS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|