C15H16IN3O2 — CID 135862424
2-cyclopropyl-6-[(5-iodofuran-2-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135862424) has the molecular formula C15H16IN3O2 and a molecular weight of 397.22 g/mol. Its IUPAC name is 2-cyclopropyl-6-[(5-iodofuran-2-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-cyclopropyl-6-[(5-iodofuran-2-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135862424 |
| Molecular Formula | C15H16IN3O2 |
| Molecular Weight | 397.22 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 2-cyclopropyl-6-[(5-iodofuran-2-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C2CC2)nc2c1CN(Cc1ccc(I)o1)CC2 |
| InChI | InChI=1S/C15H16IN3O2/c16-13-4-3-10(21-13)7-19-6-5-12-11(8-19)15(20)18-14(17-12)9-1-2-9/h3-4,9H,1-2,5-8H2,(H,17,18,20) |
| InChIKey | RDXINPVCYCQORQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|