C16H14IN5O2 — CID 135862423
6-[(5-iodofuran-2-yl)methyl]-2-pyrimidin-5-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135862423) has the molecular formula C16H14IN5O2 and a molecular weight of 435.23 g/mol. Its IUPAC name is 6-[(5-iodofuran-2-yl)methyl]-2-pyrimidin-5-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(5-iodofuran-2-yl)methyl]-2-pyrimidin-5-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135862423 |
| Molecular Formula | C16H14IN5O2 |
| Molecular Weight | 435.23 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 6-[(5-iodofuran-2-yl)methyl]-2-pyrimidin-5-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2cncnc2)nc2c1CN(Cc1ccc(I)o1)CC2 |
| InChI | InChI=1S/C16H14IN5O2/c17-14-2-1-11(24-14)7-22-4-3-13-12(8-22)16(23)21-15(20-13)10-5-18-9-19-6-10/h1-2,5-6,9H,3-4,7-8H2,(H,20,21,23) |
| InChIKey | RXPZUXWOVRIQLP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|