C19H15F3N4O4 — CID 135861614
6-[[5-(3-nitrophenyl)furan-2-yl]methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135861614) has the molecular formula C19H15F3N4O4 and a molecular weight of 420.35 g/mol. Its IUPAC name is 6-[[5-(3-nitrophenyl)furan-2-yl]methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[[5-(3-nitrophenyl)furan-2-yl]methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135861614 |
| Molecular Formula | C19H15F3N4O4 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 6-[[5-(3-nitrophenyl)furan-2-yl]methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C(F)(F)F)nc2c1CN(Cc1ccc(-c3cccc([N+](=O)[O-])c3)o1)CC2 |
| InChI | InChI=1S/C19H15F3N4O4/c20-19(21,22)18-23-15-6-7-25(10-14(15)17(27)24-18)9-13-4-5-16(30-13)11-2-1-3-12(8-11)26(28)29/h1-5,8H,6-7,9-10H2,(H,23,24,27) |
| InChIKey | AONKZHVCBZKTIA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|