C25H19F3N4O4 — CID 135861626
6-[[5-(3-nitrophenyl)furan-2-yl]methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135861626) has the molecular formula C25H19F3N4O4 and a molecular weight of 496.45 g/mol. Its IUPAC name is 6-[[5-(3-nitrophenyl)furan-2-yl]methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[[5-(3-nitrophenyl)furan-2-yl]methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135861626 |
| Molecular Formula | C25H19F3N4O4 |
| Molecular Weight | 496.45 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 6-[[5-(3-nitrophenyl)furan-2-yl]methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2ccc(C(F)(F)F)cc2)nc2c1CN(Cc1ccc(-c3cccc([N+](=O)[O-])c3)o1)CC2 |
| InChI | InChI=1S/C25H19F3N4O4/c26-25(27,28)17-6-4-15(5-7-17)23-29-21-10-11-31(14-20(21)24(33)30-23)13-19-8-9-22(36-19)16-2-1-3-18(12-16)32(34)35/h1-9,12H,10-11,13-14H2,(H,29,30,33) |
| InChIKey | JPOGQQYSARMMIS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|