C22H21N5O4 — CID 135862848
(3Z)-3-[4-amino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-yl]imino-1H-indol-2-one (PubChem CID 135862848) has the molecular formula C22H21N5O4 and a molecular weight of 419.44 g/mol. Its IUPAC name is (3Z)-3-[4-amino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-yl]imino-1H-indol-2-one.
| Compound Name | (3Z)-3-[4-amino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-yl]imino-1H-indol-2-one |
|---|---|
| PubChem CID | 135862848 |
| Molecular Formula | C22H21N5O4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | (3Z)-3-[4-amino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-yl]imino-1H-indol-2-one |
| SMILES | COc1cc(Cc2cnc(/N=C3\C(=O)Nc4ccccc43)nc2N)cc(OC)c1OC |
| InChI | InChI=1S/C22H21N5O4/c1-29-16-9-12(10-17(30-2)19(16)31-3)8-13-11-24-22(27-20(13)23)26-18-14-6-4-5-7-15(14)25-21(18)28/h4-7,9-11H,8H2,1-3H3,(H3,23,24,25,26,27,28) |
| InChIKey | SRCBLTVFKZIGIV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|