C37H35ClN6O4 — CID 15954192
(3Z)-3-[4-amino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-yl]imino-5-chloro-1-[(dibenzylamino)methyl]indol-2-one (PubChem CID 15954192) has the molecular formula C37H35ClN6O4 and a molecular weight of 663.18 g/mol. Its IUPAC name is (3Z)-3-[4-amino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-yl]imino-5-chloro-1-[(dibenzylamino)methyl]indol-2-one.
| Compound Name | (3Z)-3-[4-amino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-yl]imino-5-chloro-1-[(dibenzylamino)methyl]indol-2-one |
|---|---|
| PubChem CID | 15954192 |
| Molecular Formula | C37H35ClN6O4 |
| Molecular Weight | 663.18 g/mol |
| Exact Mass | 662.24 |
| IUPAC Name | (3Z)-3-[4-amino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-yl]imino-5-chloro-1-[(dibenzylamino)methyl]indol-2-one |
| SMILES | COc1cc(Cc2cnc(/N=C3\C(=O)N(CN(Cc4ccccc4)Cc4ccccc4)c4ccc(Cl)cc43)nc2N)cc(OC)c1OC |
| InChI | InChI=1S/C37H35ClN6O4/c1-46-31-17-26(18-32(47-2)34(31)48-3)16-27-20-40-37(42-35(27)39)41-33-29-19-28(38)14-15-30(29)44(36(33)45)23-43(21-24-10-6-4-7-11-24)22-25-12-8-5-9-13-25/h4-15,17-20H,16,21-23H2,1-3H3,(H2,39,40,42)/b41-33- |
| InChIKey | NNXVXPDHXUMGRF-AZOIZXLMSA-N |
| XLogP | 6.46 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.18 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|