C15H14F3N3O3 — CID 135863686
7-[(2,4-dihydroxyphenyl)methyl]-2-(trifluoromethyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135863686) has the molecular formula C15H14F3N3O3 and a molecular weight of 341.29 g/mol. Its IUPAC name is 7-[(2,4-dihydroxyphenyl)methyl]-2-(trifluoromethyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(2,4-dihydroxyphenyl)methyl]-2-(trifluoromethyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135863686 |
| Molecular Formula | C15H14F3N3O3 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 7-[(2,4-dihydroxyphenyl)methyl]-2-(trifluoromethyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C(F)(F)F)nc2c1CCN(Cc1ccc(O)cc1O)C2 |
| InChI | InChI=1S/C15H14F3N3O3/c16-15(17,18)14-19-11-7-21(4-3-10(11)13(24)20-14)6-8-1-2-9(22)5-12(8)23/h1-2,5,22-23H,3-4,6-7H2,(H,19,20,24) |
| InChIKey | FVCVJYYYRMRYTB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 89.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|