C22H21F2N3O2 — CID 135863992
7-[(2,6-difluoro-4-methoxyphenyl)methyl]-2-(4-methylphenyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135863992) has the molecular formula C22H21F2N3O2 and a molecular weight of 397.43 g/mol. Its IUPAC name is 7-[(2,6-difluoro-4-methoxyphenyl)methyl]-2-(4-methylphenyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(2,6-difluoro-4-methoxyphenyl)methyl]-2-(4-methylphenyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135863992 |
| Molecular Formula | C22H21F2N3O2 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 7-[(2,6-difluoro-4-methoxyphenyl)methyl]-2-(4-methylphenyl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | COc1cc(F)c(CN2CCc3c(nc(-c4ccc(C)cc4)[nH]c3=O)C2)c(F)c1 |
| InChI | InChI=1S/C22H21F2N3O2/c1-13-3-5-14(6-4-13)21-25-20-12-27(8-7-16(20)22(28)26-21)11-17-18(23)9-15(29-2)10-19(17)24/h3-6,9-10H,7-8,11-12H2,1-2H3,(H,25,26,28) |
| InChIKey | CIABIKWTUSAVQD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |