C18H15ClN6O3 — CID 135864256
7-[(2-chloro-5-nitrophenyl)methyl]-2-pyrimidin-5-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135864256) has the molecular formula C18H15ClN6O3 and a molecular weight of 398.81 g/mol. Its IUPAC name is 7-[(2-chloro-5-nitrophenyl)methyl]-2-pyrimidin-5-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(2-chloro-5-nitrophenyl)methyl]-2-pyrimidin-5-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135864256 |
| Molecular Formula | C18H15ClN6O3 |
| Molecular Weight | 398.81 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 7-[(2-chloro-5-nitrophenyl)methyl]-2-pyrimidin-5-yl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2cncnc2)nc2c1CCN(Cc1cc([N+](=O)[O-])ccc1Cl)C2 |
| InChI | InChI=1S/C18H15ClN6O3/c19-15-2-1-13(25(27)28)5-11(15)8-24-4-3-14-16(9-24)22-17(23-18(14)26)12-6-20-10-21-7-12/h1-2,5-7,10H,3-4,8-9H2,(H,22,23,26) |
| InChIKey | UVYADFLTWHOWSA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 117.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.81 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|