C20H23ClFN3O2 — CID 135865498
7-[(3-chloro-5-fluoro-2-hydroxyphenyl)methyl]-2-cyclohexyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135865498) has the molecular formula C20H23ClFN3O2 and a molecular weight of 391.87 g/mol. Its IUPAC name is 7-[(3-chloro-5-fluoro-2-hydroxyphenyl)methyl]-2-cyclohexyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(3-chloro-5-fluoro-2-hydroxyphenyl)methyl]-2-cyclohexyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135865498 |
| Molecular Formula | C20H23ClFN3O2 |
| Molecular Weight | 391.87 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 7-[(3-chloro-5-fluoro-2-hydroxyphenyl)methyl]-2-cyclohexyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C2CCCCC2)nc2c1CCN(Cc1cc(F)cc(Cl)c1O)C2 |
| InChI | InChI=1S/C20H23ClFN3O2/c21-16-9-14(22)8-13(18(16)26)10-25-7-6-15-17(11-25)23-19(24-20(15)27)12-4-2-1-3-5-12/h8-9,12,26H,1-7,10-11H2,(H,23,24,27) |
| InChIKey | KWNCZLSDKNUWNL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.87 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|