C15H15ClFN3O2 — CID 135865501
7-[(3-chloro-5-fluoro-2-hydroxyphenyl)methyl]-2-methyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135865501) has the molecular formula C15H15ClFN3O2 and a molecular weight of 323.76 g/mol. Its IUPAC name is 7-[(3-chloro-5-fluoro-2-hydroxyphenyl)methyl]-2-methyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(3-chloro-5-fluoro-2-hydroxyphenyl)methyl]-2-methyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135865501 |
| Molecular Formula | C15H15ClFN3O2 |
| Molecular Weight | 323.76 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 7-[(3-chloro-5-fluoro-2-hydroxyphenyl)methyl]-2-methyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | Cc1nc2c(c(=O)[nH]1)CCN(Cc1cc(F)cc(Cl)c1O)C2 |
| InChI | InChI=1S/C15H15ClFN3O2/c1-8-18-13-7-20(3-2-11(13)15(22)19-8)6-9-4-10(17)5-12(16)14(9)21/h4-5,21H,2-3,6-7H2,1H3,(H,18,19,22) |
| InChIKey | QJWAHXLWSYFJNY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.76 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|