C18H21ClFN3O2 — CID 135865503
2-tert-butyl-7-[(3-chloro-5-fluoro-2-hydroxyphenyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135865503) has the molecular formula C18H21ClFN3O2 and a molecular weight of 365.84 g/mol. Its IUPAC name is 2-tert-butyl-7-[(3-chloro-5-fluoro-2-hydroxyphenyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-tert-butyl-7-[(3-chloro-5-fluoro-2-hydroxyphenyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135865503 |
| Molecular Formula | C18H21ClFN3O2 |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 2-tert-butyl-7-[(3-chloro-5-fluoro-2-hydroxyphenyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | CC(C)(C)c1nc2c(c(=O)[nH]1)CCN(Cc1cc(F)cc(Cl)c1O)C2 |
| InChI | InChI=1S/C18H21ClFN3O2/c1-18(2,3)17-21-14-9-23(5-4-12(14)16(25)22-17)8-10-6-11(20)7-13(19)15(10)24/h6-7,24H,4-5,8-9H2,1-3H3,(H,21,22,25) |
| InChIKey | KVDUCDSUDGVNKX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|