C14H18N4O3S2 — CID 135866274
7-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylsulfonyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135866274) has the molecular formula C14H18N4O3S2 and a molecular weight of 354.46 g/mol. Its IUPAC name is 7-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylsulfonyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylsulfonyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135866274 |
| Molecular Formula | C14H18N4O3S2 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 7-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylsulfonyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | Cc1nc(C)c(CN2CCc3c(nc(S(C)(=O)=O)[nH]c3=O)C2)s1 |
| InChI | InChI=1S/C14H18N4O3S2/c1-8-12(22-9(2)15-8)7-18-5-4-10-11(6-18)16-14(17-13(10)19)23(3,20)21/h4-7H2,1-3H3,(H,16,17,19) |
| InChIKey | NVEGLTHZHLFLAY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |