C15H14ClF2N3O3S — CID 135865292
7-[(3-chloro-2,6-difluorophenyl)methyl]-2-methylsulfonyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135865292) has the molecular formula C15H14ClF2N3O3S and a molecular weight of 389.81 g/mol. Its IUPAC name is 7-[(3-chloro-2,6-difluorophenyl)methyl]-2-methylsulfonyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(3-chloro-2,6-difluorophenyl)methyl]-2-methylsulfonyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135865292 |
| Molecular Formula | C15H14ClF2N3O3S |
| Molecular Weight | 389.81 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 7-[(3-chloro-2,6-difluorophenyl)methyl]-2-methylsulfonyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | CS(=O)(=O)c1nc2c(c(=O)[nH]1)CCN(Cc1c(F)ccc(Cl)c1F)C2 |
| InChI | InChI=1S/C15H14ClF2N3O3S/c1-25(23,24)15-19-12-7-21(5-4-8(12)14(22)20-15)6-9-11(17)3-2-10(16)13(9)18/h2-3H,4-7H2,1H3,(H,19,20,22) |
| InChIKey | RMRXZYXSLVQTEZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.81 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|