C17H18ClF2N3O — CID 135865291
7-[(3-chloro-2,6-difluorophenyl)methyl]-2-propyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135865291) has the molecular formula C17H18ClF2N3O and a molecular weight of 353.80 g/mol. Its IUPAC name is 7-[(3-chloro-2,6-difluorophenyl)methyl]-2-propyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(3-chloro-2,6-difluorophenyl)methyl]-2-propyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135865291 |
| Molecular Formula | C17H18ClF2N3O |
| Molecular Weight | 353.80 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 7-[(3-chloro-2,6-difluorophenyl)methyl]-2-propyl-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | CCCc1nc2c(c(=O)[nH]1)CCN(Cc1c(F)ccc(Cl)c1F)C2 |
| InChI | InChI=1S/C17H18ClF2N3O/c1-2-3-15-21-14-9-23(7-6-10(14)17(24)22-15)8-11-13(19)5-4-12(18)16(11)20/h4-5H,2-3,6-9H2,1H3,(H,21,22,24) |
| InChIKey | CVOXGNZJGLRPHD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.80 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|