C18H14ClF2N3O2 — CID 135865293
7-[(3-chloro-2,6-difluorophenyl)methyl]-2-(furan-2-yl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135865293) has the molecular formula C18H14ClF2N3O2 and a molecular weight of 377.78 g/mol. Its IUPAC name is 7-[(3-chloro-2,6-difluorophenyl)methyl]-2-(furan-2-yl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(3-chloro-2,6-difluorophenyl)methyl]-2-(furan-2-yl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135865293 |
| Molecular Formula | C18H14ClF2N3O2 |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 7-[(3-chloro-2,6-difluorophenyl)methyl]-2-(furan-2-yl)-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2ccco2)nc2c1CCN(Cc1c(F)ccc(Cl)c1F)C2 |
| InChI | InChI=1S/C18H14ClF2N3O2/c19-12-3-4-13(20)11(16(12)21)8-24-6-5-10-14(9-24)22-17(23-18(10)25)15-2-1-7-26-15/h1-4,7H,5-6,8-9H2,(H,22,23,25) |
| InChIKey | FBGKISYLLAXBSU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|