C19H18ClN5O — CID 135866778
2-(4-aminophenyl)-7-[(6-chloro-3-pyridinyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135866778) has the molecular formula C19H18ClN5O and a molecular weight of 367.84 g/mol. Its IUPAC name is 2-(4-aminophenyl)-7-[(6-chloro-3-pyridinyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-(4-aminophenyl)-7-[(6-chloro-3-pyridinyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135866778 |
| Molecular Formula | C19H18ClN5O |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-(4-aminophenyl)-7-[(6-chloro-3-pyridinyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | Nc1ccc(-c2nc3c(c(=O)[nH]2)CCN(Cc2ccc(Cl)nc2)C3)cc1 |
| InChI | InChI=1S/C19H18ClN5O/c20-17-6-1-12(9-22-17)10-25-8-7-15-16(11-25)23-18(24-19(15)26)13-2-4-14(21)5-3-13/h1-6,9H,7-8,10-11,21H2,(H,23,24,26) |
| InChIKey | CINTYIOQVKMRPZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|