C25H21Cl2N5O — CID 135945893
2-(4-aminophenyl)-6-[[6-(3,4-dichlorophenyl)-3-pyridinyl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135945893) has the molecular formula C25H21Cl2N5O and a molecular weight of 478.38 g/mol. Its IUPAC name is 2-(4-aminophenyl)-6-[[6-(3,4-dichlorophenyl)-3-pyridinyl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(4-aminophenyl)-6-[[6-(3,4-dichlorophenyl)-3-pyridinyl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135945893 |
| Molecular Formula | C25H21Cl2N5O |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 2-(4-aminophenyl)-6-[[6-(3,4-dichlorophenyl)-3-pyridinyl]methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Nc1ccc(-c2nc3c(c(=O)[nH]2)CN(Cc2ccc(-c4ccc(Cl)c(Cl)c4)nc2)CC3)cc1 |
| InChI | InChI=1S/C25H21Cl2N5O/c26-20-7-4-17(11-21(20)27)22-8-1-15(12-29-22)13-32-10-9-23-19(14-32)25(33)31-24(30-23)16-2-5-18(28)6-3-16/h1-8,11-12H,9-10,13-14,28H2,(H,30,31,33) |
| InChIKey | IWMCUFFLYNKBLN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|