C22H20FN5O — CID 135866798
2-(4-aminophenyl)-7-[(6-fluoro-1H-indol-3-yl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135866798) has the molecular formula C22H20FN5O and a molecular weight of 389.43 g/mol. Its IUPAC name is 2-(4-aminophenyl)-7-[(6-fluoro-1H-indol-3-yl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-(4-aminophenyl)-7-[(6-fluoro-1H-indol-3-yl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135866798 |
| Molecular Formula | C22H20FN5O |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 2-(4-aminophenyl)-7-[(6-fluoro-1H-indol-3-yl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | Nc1ccc(-c2nc3c(c(=O)[nH]2)CCN(Cc2c[nH]c4cc(F)ccc24)C3)cc1 |
| InChI | InChI=1S/C22H20FN5O/c23-15-3-6-17-14(10-25-19(17)9-15)11-28-8-7-18-20(12-28)26-21(27-22(18)29)13-1-4-16(24)5-2-13/h1-6,9-10,25H,7-8,11-12,24H2,(H,26,27,29) |
| InChIKey | DSSQOIKPZKQGBK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|