C22H20FN5 — CID 24931049
4-[7-[(5-fluoro-1H-indol-3-yl)methyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]aniline (PubChem CID 24931049) has the molecular formula C22H20FN5 and a molecular weight of 373.44 g/mol. Its IUPAC name is 4-[7-[(5-fluoro-1H-indol-3-yl)methyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]aniline.
| Compound Name | 4-[7-[(5-fluoro-1H-indol-3-yl)methyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 24931049 |
| Molecular Formula | C22H20FN5 |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 4-[7-[(5-fluoro-1H-indol-3-yl)methyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]aniline |
| SMILES | Nc1ccc(-c2ncc3c(n2)CN(Cc2c[nH]c4ccc(F)cc24)CC3)cc1 |
| InChI | InChI=1S/C22H20FN5/c23-17-3-6-20-19(9-17)16(11-25-20)12-28-8-7-15-10-26-22(27-21(15)13-28)14-1-4-18(24)5-2-14/h1-6,9-11,25H,7-8,12-13,24H2 |
| InChIKey | OOKXSTIKTQGKGF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|