C20H17F3N4 — CID 24928413
4-[6-[(2,4,5-trifluorophenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline (PubChem CID 24928413) has the molecular formula C20H17F3N4 and a molecular weight of 370.38 g/mol. Its IUPAC name is 4-[6-[(2,4,5-trifluorophenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline.
| Compound Name | 4-[6-[(2,4,5-trifluorophenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 24928413 |
| Molecular Formula | C20H17F3N4 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 4-[6-[(2,4,5-trifluorophenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline |
| SMILES | Nc1ccc(-c2ncc3c(n2)CCN(Cc2cc(F)c(F)cc2F)C3)cc1 |
| InChI | InChI=1S/C20H17F3N4/c21-16-8-18(23)17(22)7-13(16)10-27-6-5-19-14(11-27)9-25-20(26-19)12-1-3-15(24)4-2-12/h1-4,7-9H,5-6,10-11,24H2 |
| InChIKey | QZGBSUPSKGAVHM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|