C25H22FN5 — CID 24912093
4-[6-[[5-(4-fluorophenyl)-3-pyridinyl]methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline (PubChem CID 24912093) has the molecular formula C25H22FN5 and a molecular weight of 411.48 g/mol. Its IUPAC name is 4-[6-[[5-(4-fluorophenyl)-3-pyridinyl]methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline.
| Compound Name | 4-[6-[[5-(4-fluorophenyl)-3-pyridinyl]methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 24912093 |
| Molecular Formula | C25H22FN5 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 4-[6-[[5-(4-fluorophenyl)-3-pyridinyl]methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline |
| SMILES | Nc1ccc(-c2ncc3c(n2)CCN(Cc2cncc(-c4ccc(F)cc4)c2)C3)cc1 |
| InChI | InChI=1S/C25H22FN5/c26-22-5-1-18(2-6-22)20-11-17(12-28-13-20)15-31-10-9-24-21(16-31)14-29-25(30-24)19-3-7-23(27)8-4-19/h1-8,11-14H,9-10,15-16,27H2 |
| InChIKey | UZTSDAFPXAHDDW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|