C28H24FN5 — CID 24910833
4-[6-[[2-(4-fluorophenyl)-1H-indol-3-yl]methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline (PubChem CID 24910833) has the molecular formula C28H24FN5 and a molecular weight of 449.53 g/mol. Its IUPAC name is 4-[6-[[2-(4-fluorophenyl)-1H-indol-3-yl]methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline.
| Compound Name | 4-[6-[[2-(4-fluorophenyl)-1H-indol-3-yl]methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 24910833 |
| Molecular Formula | C28H24FN5 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 4-[6-[[2-(4-fluorophenyl)-1H-indol-3-yl]methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline |
| SMILES | Nc1ccc(-c2ncc3c(n2)CCN(Cc2c(-c4ccc(F)cc4)[nH]c4ccccc24)C3)cc1 |
| InChI | InChI=1S/C28H24FN5/c29-21-9-5-18(6-10-21)27-24(23-3-1-2-4-26(23)32-27)17-34-14-13-25-20(16-34)15-31-28(33-25)19-7-11-22(30)12-8-19/h1-12,15,32H,13-14,16-17,30H2 |
| InChIKey | CWKZRHOBPGIJKV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|