C18H19N5O — CID 24916062
4-[6-[(5-methyl-1,2-oxazol-3-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline (PubChem CID 24916062) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 4-[6-[(5-methyl-1,2-oxazol-3-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline.
| Compound Name | 4-[6-[(5-methyl-1,2-oxazol-3-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 24916062 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 4-[6-[(5-methyl-1,2-oxazol-3-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline |
| SMILES | Cc1cc(CN2CCc3nc(-c4ccc(N)cc4)ncc3C2)no1 |
| InChI | InChI=1S/C18H19N5O/c1-12-8-16(22-24-12)11-23-7-6-17-14(10-23)9-20-18(21-17)13-2-4-15(19)5-3-13/h2-5,8-9H,6-7,10-11,19H2,1H3 |
| InChIKey | CBDNUQGTWGIHLY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|