C22H21N7 — CID 24909720
4-[6-[(1-phenyltriazol-4-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline (PubChem CID 24909720) has the molecular formula C22H21N7 and a molecular weight of 383.46 g/mol. Its IUPAC name is 4-[6-[(1-phenyltriazol-4-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline.
| Compound Name | 4-[6-[(1-phenyltriazol-4-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 24909720 |
| Molecular Formula | C22H21N7 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 4-[6-[(1-phenyltriazol-4-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline |
| SMILES | Nc1ccc(-c2ncc3c(n2)CCN(Cc2cn(-c4ccccc4)nn2)C3)cc1 |
| InChI | InChI=1S/C22H21N7/c23-18-8-6-16(7-9-18)22-24-12-17-13-28(11-10-21(17)25-22)14-19-15-29(27-26-19)20-4-2-1-3-5-20/h1-9,12,15H,10-11,13-14,23H2 |
| InChIKey | XEZKYTUZTRRGDK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|